C24H18F2N4O — CID 89175551
N-(4-fluorophenyl)-4-[(3Z)-3-[(4-fluorophenyl)-methoxymethylidene]-4-iminocyclohexa-1,5-dien-1-yl]pyrimidin-2-amine (PubChem CID 89175551) has the molecular formula C24H18F2N4O and a molecular weight of 416.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[(3Z)-3-[(4-fluorophenyl)-methoxymethylidene]-4-iminocyclohexa-1,5-dien-1-yl]pyrimidin-2-amine.
| Compound Name | N-(4-fluorophenyl)-4-[(3Z)-3-[(4-fluorophenyl)-methoxymethylidene]-4-iminocyclohexa-1,5-dien-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89175551 |
| Molecular Formula | C24H18F2N4O |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(4-fluorophenyl)-4-[(3Z)-3-[(4-fluorophenyl)-methoxymethylidene]-4-iminocyclohexa-1,5-dien-1-yl]pyrimidin-2-amine |
| SMILES | [H]/N=C1\C=CC(c2ccnc(Nc3ccc(F)cc3)n2)=C\C1=C(\OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18F2N4O/c1-31-23(15-2-5-17(25)6-3-15)20-14-16(4-11-21(20)27)22-12-13-28-24(30-22)29-19-9-7-18(26)8-10-19/h2-14,27H,1H3,(H,28,29,30)/b23-20-,27-21+ |
| InChIKey | WALREDVFKZCJSW-XSBZQNGPSA-N |
| XLogP | 5.53 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|