C34H57N7O10S — CID 89177407
N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-[1-[(4-methylphenyl)sulfonylamino]ethenylamino]pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide (PubChem CID 89177407) has the molecular formula C34H57N7O10S and a molecular weight of 755.94 g/mol. Its IUPAC name is N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-[1-[(4-methylphenyl)sulfonylamino]ethenylamino]pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide.
| Compound Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-[1-[(4-methylphenyl)sulfonylamino]ethenylamino]pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 89177407 |
| Molecular Formula | C34H57N7O10S |
| Molecular Weight | 755.94 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-[1-[(4-methylphenyl)sulfonylamino]ethenylamino]pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide |
| SMILES | C=C(NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(C)=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H57N7O10S/c1-27-13-15-30(16-14-27)52(50,51)38-28(2)35-21-7-4-11-25-40(48)33(45)19-18-32(44)37-23-9-6-12-26-41(49)34(46)20-17-31(43)36-22-8-5-10-24-39(47)29(3)42/h13-16,35,38,47-49H,2,4-12,17-26H2,1,3H3,(H,36,43)(H,37,44) |
| InChIKey | XKQLLQGKDWZTHD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 238.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.94 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|