C15H22N2O6 — CID 89178665
ethyl (2S)-2-[[(2R)-1-methylperoxy-3-(4-nitrophenyl)propan-2-yl]amino]propanoate (PubChem CID 89178665) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-1-methylperoxy-3-(4-nitrophenyl)propan-2-yl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-1-methylperoxy-3-(4-nitrophenyl)propan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 89178665 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-1-methylperoxy-3-(4-nitrophenyl)propan-2-yl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[C@@H](COOC)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H22N2O6/c1-4-22-15(18)11(2)16-13(10-23-21-3)9-12-5-7-14(8-6-12)17(19)20/h5-8,11,13,16H,4,9-10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | JBMWOVSECSQWCK-WCQYABFASA-N |
| XLogP | 1.63 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|