C12H8Cl2IN3O — CID 89178764
N-(4,6-dichloropyrimidin-5-yl)-2-(3-iodophenyl)acetamide (PubChem CID 89178764) has the molecular formula C12H8Cl2IN3O and a molecular weight of 408.03 g/mol. Its IUPAC name is N-(4,6-dichloropyrimidin-5-yl)-2-(3-iodophenyl)acetamide.
| Compound Name | N-(4,6-dichloropyrimidin-5-yl)-2-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 89178764 |
| Molecular Formula | C12H8Cl2IN3O |
| Molecular Weight | 408.03 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | N-(4,6-dichloropyrimidin-5-yl)-2-(3-iodophenyl)acetamide |
| SMILES | O=C(Cc1cccc(I)c1)Nc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C12H8Cl2IN3O/c13-11-10(12(14)17-6-16-11)18-9(19)5-7-2-1-3-8(15)4-7/h1-4,6H,5H2,(H,18,19) |
| InChIKey | FTLDFSRISADYQR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.03 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|