C7H12F3IN2 — CID 89182313
3-methyl-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine (PubChem CID 89182313) has the molecular formula C7H12F3IN2 and a molecular weight of 308.09 g/mol. Its IUPAC name is 3-methyl-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine.
| Compound Name | 3-methyl-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 89182313 |
| Molecular Formula | C7H12F3IN2 |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-methyl-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine |
| SMILES | CC1(N)CCN(C(I)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H12F3IN2/c1-6(12)2-3-13(4-6)5(11)7(8,9)10/h5H,2-4,12H2,1H3 |
| InChIKey | VXBVTABSVJRKSL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|