C19H17N5O — CID 89183237
N-(2-amino-5-pyridin-4-ylphenyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide (PubChem CID 89183237) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(2-amino-5-pyridin-4-ylphenyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide.
| Compound Name | N-(2-amino-5-pyridin-4-ylphenyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 89183237 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-(2-amino-5-pyridin-4-ylphenyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
| SMILES | Nc1ccc(-c2ccncc2)cc1NC(=O)N1Cc2cccnc2C1 |
| InChI | InChI=1S/C19H17N5O/c20-16-4-3-14(13-5-8-21-9-6-13)10-17(16)23-19(25)24-11-15-2-1-7-22-18(15)12-24/h1-10H,11-12,20H2,(H,23,25) |
| InChIKey | HBVGDVAWXPRPMH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|