C20H15FN2O2S — CID 8918412
(E)-N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 8918412) has the molecular formula C20H15FN2O2S and a molecular weight of 366.42 g/mol. Its IUPAC name is (E)-N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8918412 |
| Molecular Formula | C20H15FN2O2S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (E)-N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | CC(=O)c1sc(NC(=O)/C=C/c2ccccc2F)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H15FN2O2S/c1-13(24)19-18(15-8-3-2-4-9-15)23-20(26-19)22-17(25)12-11-14-7-5-6-10-16(14)21/h2-12H,1H3,(H,22,23,25)/b12-11+ |
| InChIKey | RSMLJVLDUHTALC-VAWYXSNFSA-N |
| XLogP | 4.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|