(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid

C13H23NO3 — CID 89188175

IUPAC(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid
SMILESCCCCC(C)C(C)CNC(=O)/C=C\C(=O)O
InChIInChI=1S/C13H23NO3/c1-4-5-6-10(2)11(3)9-14-12(15)7-8-13(16)17/h7-8,10-11H,4-6,9H2,1-3H3,(H,14,15)(H,16,17)/b8-7-
InChIKeyZZGRQONLIMGQSW-FPLPWBNLSA-N
MW241.33 g/mol
LogP2.21
Rot. Bonds8

About (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid

(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid (PubChem CID 89188175) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid
PubChem CID89188175
Molecular FormulaC13H23NO3
Molecular Weight241.33 g/mol
Exact Mass241.17
IUPAC Name(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid
SMILESCCCCC(C)C(C)CNC(=O)/C=C\C(=O)O
InChIInChI=1S/C13H23NO3/c1-4-5-6-10(2)11(3)9-14-12(15)7-8-13(16)17/h7-8,10-11H,4-6,9H2,1-3H3,(H,14,15)(H,16,17)/b8-7-
InChIKeyZZGRQONLIMGQSW-FPLPWBNLSA-N
XLogP2.21
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.33
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid (CID 89188175) is (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid is CCCCC(C)C(C)CNC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid?
The InChIKey is ZZGRQONLIMGQSW-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H23NO3/c1-4-5-6-10(2)11(3)9-14-12(15)7-8-13(16)17/h7-8,10-11H,4-6,9H2,1-3H3,(H,14,15)(H,16,17)/b8-7-.
What are the key properties of (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid?
(Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid has a molecular weight of 241.33 g/mol, XLogP of 2.21, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(2,3-dimethylheptylamino)-4-oxobut-2-enoic acid is sourced from PubChem (CID 89188175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).