C27H28N2O2 — CID 89190387
phenyl N-[(2Z)-2-[3-(dimethylamino)propylidene]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]carbamate (PubChem CID 89190387) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is phenyl N-[(2Z)-2-[3-(dimethylamino)propylidene]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]carbamate.
| Compound Name | phenyl N-[(2Z)-2-[3-(dimethylamino)propylidene]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]carbamate |
|---|---|
| PubChem CID | 89190387 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | phenyl N-[(2Z)-2-[3-(dimethylamino)propylidene]-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]carbamate |
| SMILES | CN(C)CC/C=C1/c2ccccc2CCc2ccc(NC(=O)Oc3ccccc3)cc21 |
| InChI | InChI=1S/C27H28N2O2/c1-29(2)18-8-13-25-24-12-7-6-9-20(24)14-15-21-16-17-22(19-26(21)25)28-27(30)31-23-10-4-3-5-11-23/h3-7,9-13,16-17,19H,8,14-15,18H2,1-2H3,(H,28,30)/b25-13- |
| InChIKey | JHFUMZHXCSBYJK-MXAYSNPKSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|