C32H44BClN4O7 — CID 89199186
tert-butyl N-[6-chloro-3-[(2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (PubChem CID 89199186) has the molecular formula C32H44BClN4O7 and a molecular weight of 642.99 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-3-[(2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-3-[(2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 89199186 |
| Molecular Formula | C32H44BClN4O7 |
| Molecular Weight | 642.99 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | tert-butyl N-[6-chloro-3-[(2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(Cl)c(B2OC(C)(C)C(C)(C)O2)cc1OC[C@H](Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H44BClN4O7/c1-29(2,3)42-27(39)36-20(15-19-17-35-23-14-12-11-13-21(19)23)18-41-24-16-22(33-44-31(7,8)32(9,10)45-33)25(34)37-26(24)38-28(40)43-30(4,5)6/h11-14,16-17,20,35H,15,18H2,1-10H3,(H,36,39)(H,37,38,40)/t20-/m0/s1 |
| InChIKey | JRMVILFMTJNYRE-FQEVSTJZSA-N |
| XLogP | 6.38 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.99 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|