C24H25ClN4O3 — CID 20744882
tert-butyl N-[1-[[5-chloro-4-[(E)-2-cyanoethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-yl]carbamate (PubChem CID 20744882) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-chloro-4-[(E)-2-cyanoethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-chloro-4-[(E)-2-cyanoethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 20744882 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | tert-butyl N-[1-[[5-chloro-4-[(E)-2-cyanoethenyl]-3-pyridinyl]oxy]-3-(1H-indol-3-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(COc1cncc(Cl)c1/C=C/C#N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25ClN4O3/c1-24(2,3)32-23(30)29-17(11-16-12-28-21-9-5-4-7-18(16)21)15-31-22-14-27-13-20(25)19(22)8-6-10-26/h4-9,12-14,17,28H,11,15H2,1-3H3,(H,29,30)/b8-6+ |
| InChIKey | LZQXQDAIEDNBIR-SOFGYWHQSA-N |
| XLogP | 5.27 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|