C27H21Cl2F4N5O3 — CID 89200633
N-[(2S)-1-amino-1-oxo-3-(2,3,4,5-tetrafluorophenyl)propan-2-yl]-4-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide (PubChem CID 89200633) has the molecular formula C27H21Cl2F4N5O3 and a molecular weight of 610.40 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxo-3-(2,3,4,5-tetrafluorophenyl)propan-2-yl]-4-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide.
| Compound Name | N-[(2S)-1-amino-1-oxo-3-(2,3,4,5-tetrafluorophenyl)propan-2-yl]-4-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide |
|---|---|
| PubChem CID | 89200633 |
| Molecular Formula | C27H21Cl2F4N5O3 |
| Molecular Weight | 610.40 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | N-[(2S)-1-amino-1-oxo-3-(2,3,4,5-tetrafluorophenyl)propan-2-yl]-4-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide |
| SMILES | NC(=O)[C@H](Cc1cc(F)c(F)c(F)c1F)NC(=O)CCCOc1cc(-c2cccnc2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H21Cl2F4N5O3/c28-17-6-5-16(11-18(17)29)38-23(12-20(37-38)14-3-1-7-35-13-14)41-8-2-4-22(39)36-21(27(34)40)10-15-9-19(30)25(32)26(33)24(15)31/h1,3,5-7,9,11-13,21H,2,4,8,10H2,(H2,34,40)(H,36,39)/t21-/m0/s1 |
| InChIKey | PYMHFSFFISTCJQ-NRFANRHFSA-N |
| XLogP | 5.17 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|