C27H26N6O5 — CID 58784815
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[1-(4-nitrophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide (PubChem CID 58784815) has the molecular formula C27H26N6O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[1-(4-nitrophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide.
| Compound Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[1-(4-nitrophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide |
|---|---|
| PubChem CID | 58784815 |
| Molecular Formula | C27H26N6O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[1-(4-nitrophenyl)-3-pyridin-3-ylpyrazol-5-yl]oxybutanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)CCCOc1cc(-c2cccnc2)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26N6O5/c28-27(35)24(16-19-6-2-1-3-7-19)30-25(34)9-5-15-38-26-17-23(20-8-4-14-29-18-20)31-32(26)21-10-12-22(13-11-21)33(36)37/h1-4,6-8,10-14,17-18,24H,5,9,15-16H2,(H2,28,35)(H,30,34)/t24-/m0/s1 |
| InChIKey | YFCVQNANFJXLQS-DEOSSOPVSA-N |
| XLogP | 3.21 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|