C23H29BN2O — CID 89204478
CID 89204478 (PubChem CID 89204478) has the molecular formula C23H29BN2O and a molecular weight of 360.31 g/mol.
| Compound Name | CID 89204478 |
|---|---|
| PubChem CID | 89204478 |
| Molecular Formula | C23H29BN2O |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CN2CCc3c2cc(C)c(NC(=O)CC(C)(C)C)c3C)cc1 |
| InChI | InChI=1S/C23H29BN2O/c1-15-12-20-19(16(2)22(15)25-21(27)13-23(3,4)5)10-11-26(20)14-17-6-8-18(24)9-7-17/h6-9,12H,10-11,13-14H2,1-5H3,(H,25,27) |
| InChIKey | JSHBELLLMPTXOP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|