C19H21NO2 — CID 8921028
N-(2,3-dihydro-1H-inden-5-yl)-3-(3-methylphenoxy)propanamide (PubChem CID 8921028) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-3-(3-methylphenoxy)propanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 8921028 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-3-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)Nc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C19H21NO2/c1-14-4-2-7-18(12-14)22-11-10-19(21)20-17-9-8-15-5-3-6-16(15)13-17/h2,4,7-9,12-13H,3,5-6,10-11H2,1H3,(H,20,21) |
| InChIKey | GVBGSWJGEBLYDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |