C20H22ClNO2 — CID 8892876
4-(4-chloro-3-methylphenoxy)-N-(2,3-dihydro-1H-inden-5-yl)butanamide (PubChem CID 8892876) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-(2,3-dihydro-1H-inden-5-yl)butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-(2,3-dihydro-1H-inden-5-yl)butanamide |
|---|---|
| PubChem CID | 8892876 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-(2,3-dihydro-1H-inden-5-yl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc3c(c2)CCC3)ccc1Cl |
| InChI | InChI=1S/C20H22ClNO2/c1-14-12-18(9-10-19(14)21)24-11-3-6-20(23)22-17-8-7-15-4-2-5-16(15)13-17/h7-10,12-13H,2-6,11H2,1H3,(H,22,23) |
| InChIKey | AEOOTLDYZQWIFB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|