C26H32BN3O — CID 89210393
CID 89210393 (PubChem CID 89210393) has the molecular formula C26H32BN3O and a molecular weight of 413.37 g/mol.
| Compound Name | CID 89210393 |
|---|---|
| PubChem CID | 89210393 |
| Molecular Formula | C26H32BN3O |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(C)OCC2(c3ccccc3)CCN(C)CC2)c2ncn(CC3CC3)c2c1 |
| InChI | InChI=1S/C26H32BN3O/c1-19(23-14-22(27)15-24-25(23)28-18-30(24)16-20-8-9-20)31-17-26(10-12-29(2)13-11-26)21-6-4-3-5-7-21/h3-7,14-15,18-20H,8-13,16-17H2,1-2H3 |
| InChIKey | BTSJVQSZCJMWER-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|