C23H26O14 — CID 89211982
[3,4,5-trimethoxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 2,3,4-trihydroxybenzoate (PubChem CID 89211982) has the molecular formula C23H26O14 and a molecular weight of 526.45 g/mol. Its IUPAC name is [3,4,5-trimethoxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 2,3,4-trihydroxybenzoate.
| Compound Name | [3,4,5-trimethoxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 2,3,4-trihydroxybenzoate |
|---|---|
| PubChem CID | 89211982 |
| Molecular Formula | C23H26O14 |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | [3,4,5-trimethoxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 2,3,4-trihydroxybenzoate |
| SMILES | COC1C(COC(=O)c2ccc(O)c(O)c2O)OC(OC(=O)c2cc(O)c(O)c(O)c2)C(OC)C1OC |
| InChI | InChI=1S/C23H26O14/c1-32-18-14(8-35-22(31)10-4-5-11(24)17(29)15(10)27)36-23(20(34-3)19(18)33-2)37-21(30)9-6-12(25)16(28)13(26)7-9/h4-7,14,18-20,23-29H,8H2,1-3H3 |
| InChIKey | ATMCIBFXPLGXGE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 210.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|