C20H19N3O3 — CID 892137
5-(4-ethoxyanilino)-2-(4-ethoxyphenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 892137) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 5-(4-ethoxyanilino)-2-(4-ethoxyphenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(4-ethoxyanilino)-2-(4-ethoxyphenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 892137 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-(4-ethoxyanilino)-2-(4-ethoxyphenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | CCOc1ccc(Nc2oc(-c3ccc(OCC)cc3)nc2C#N)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-3-24-16-9-5-14(6-10-16)19-23-18(13-21)20(26-19)22-15-7-11-17(12-8-15)25-4-2/h5-12,22H,3-4H2,1-2H3 |
| InChIKey | BLEFGFLSIDNQJB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |