C19H21N3O3 — CID 70846683
5-N,2-bis(4-ethoxyphenyl)-1,3-oxazole-4,5-diamine (PubChem CID 70846683) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-N,2-bis(4-ethoxyphenyl)-1,3-oxazole-4,5-diamine.
| Compound Name | 5-N,2-bis(4-ethoxyphenyl)-1,3-oxazole-4,5-diamine |
|---|---|
| PubChem CID | 70846683 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-N,2-bis(4-ethoxyphenyl)-1,3-oxazole-4,5-diamine |
| SMILES | CCOc1ccc(Nc2oc(-c3ccc(OCC)cc3)nc2N)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-3-23-15-9-5-13(6-10-15)18-22-17(20)19(25-18)21-14-7-11-16(12-8-14)24-4-2/h5-12,21H,3-4,20H2,1-2H3 |
| InChIKey | LLLJYBWFLXZLPR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |