About 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile
2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile (PubChem CID 18822660) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 18822660 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile |
| SMILES | CCOc1ccc(Nc2oc(-c3ccc(OC)c(OC)c3)nc2C#N)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-4-26-15-8-6-14(7-9-15)22-20-16(12-21)23-19(27-20)13-5-10-17(24-2)18(11-13)25-3/h5-11,22H,4H2,1-3H3 |
| InChIKey | GAJBLLUAEMXZEM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile (CID 18822660) is 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile is CCOc1ccc(Nc2oc(-c3ccc(OC)c(OC)c3)nc2C#N)cc1.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile?
The InChIKey is GAJBLLUAEMXZEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-4-26-15-8-6-14(7-9-15)22-20-16(12-21)23-19(27-20)13-5-10-17(24-2)18(11-13)25-3/h5-11,22H,4H2,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile?
2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile has a molecular weight of 365.39 g/mol, XLogP of 4.37, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-5-(4-ethoxyanilino)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 18822660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).