C22H25N3OS — CID 89215031
4-(propan-2-ylsulfanylamino)-N-[4-(pyridin-4-ylmethyl)phenyl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 89215031) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 4-(propan-2-ylsulfanylamino)-N-[4-(pyridin-4-ylmethyl)phenyl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-(propan-2-ylsulfanylamino)-N-[4-(pyridin-4-ylmethyl)phenyl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 89215031 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-(propan-2-ylsulfanylamino)-N-[4-(pyridin-4-ylmethyl)phenyl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC(C)SNC1=CC=C(C(=O)Nc2ccc(Cc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C22H25N3OS/c1-16(2)27-25-21-9-5-19(6-10-21)22(26)24-20-7-3-17(4-8-20)15-18-11-13-23-14-12-18/h3-5,7-9,11-14,16,25H,6,10,15H2,1-2H3,(H,24,26) |
| InChIKey | BPRZMDZHQCDHNN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|