C21H26BF3N4 — CID 89216463
CID 89216463 (PubChem CID 89216463) has the molecular formula C21H26BF3N4 and a molecular weight of 402.27 g/mol.
| Compound Name | CID 89216463 |
|---|---|
| PubChem CID | 89216463 |
| Molecular Formula | C21H26BF3N4 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(C#N)(N2CCN(C3CCc4ccc(C(F)(F)F)cc43)C(C)C2)CC1 |
| InChI | InChI=1S/C21H26BF3N4/c1-15-13-27(20(14-26)6-8-28(22)9-7-20)10-11-29(15)19-5-3-16-2-4-17(12-18(16)19)21(23,24)25/h2,4,12,15,19H,3,5-11,13H2,1H3 |
| InChIKey | VLYXSRYPWCZRJI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|