C20H28F2O2 — CID 89217513
2-[5-ethyl-2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]phenyl]oxirane (PubChem CID 89217513) has the molecular formula C20H28F2O2 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[5-ethyl-2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]phenyl]oxirane.
| Compound Name | 2-[5-ethyl-2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]phenyl]oxirane |
|---|---|
| PubChem CID | 89217513 |
| Molecular Formula | C20H28F2O2 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[5-ethyl-2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]phenyl]oxirane |
| SMILES | CCCC1CCC(COc2c(CC)cc(C3CO3)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H28F2O2/c1-3-5-13-6-8-14(9-7-13)11-24-20-15(4-2)10-16(17-12-23-17)18(21)19(20)22/h10,13-14,17H,3-9,11-12H2,1-2H3 |
| InChIKey | PHPCDTYCOQCCDF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|