C23H25FN3O2P — CID 89217536
N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-2-[2-[(Z)-3-imino-1-phosphanylprop-1-enyl]phenoxy]acetamide (PubChem CID 89217536) has the molecular formula C23H25FN3O2P and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-2-[2-[(Z)-3-imino-1-phosphanylprop-1-enyl]phenoxy]acetamide.
| Compound Name | N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-2-[2-[(Z)-3-imino-1-phosphanylprop-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 89217536 |
| Molecular Formula | C23H25FN3O2P |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-2-[2-[(Z)-3-imino-1-phosphanylprop-1-enyl]phenoxy]acetamide |
| SMILES | [H]/N=C/C=C(\P)c1ccccc1OCC(=O)NCCc1c(C)[nH]c2c(F)ccc(C)c12 |
| InChI | InChI=1S/C23H25FN3O2P/c1-14-7-8-18(24)23-22(14)16(15(2)27-23)10-12-26-21(28)13-29-19-6-4-3-5-17(19)20(30)9-11-25/h3-9,11,25,27H,10,12-13,30H2,1-2H3,(H,26,28)/b20-9-,25-11+ |
| InChIKey | UIJAIJSULGHAJL-VGECYSEQSA-N |
| XLogP | 4.53 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|