C29H34BN3O6S — CID 89218056
tert-butyl 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 89218056) has the molecular formula C29H34BN3O6S and a molecular weight of 563.49 g/mol. Its IUPAC name is tert-butyl 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89218056 |
| Molecular Formula | C29H34BN3O6S |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | tert-butyl 5-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C1OB(c2ccnc3c2cc(C2=CN(C(=O)OC(C)(C)C)CCC2)n3S(=O)(=O)c2ccc(C)cc2)OC1(C)C |
| InChI | InChI=1S/C29H34BN3O6S/c1-19-10-12-22(13-11-19)40(35,36)33-25(21-9-8-16-32(18-21)27(34)37-28(3,4)5)17-23-24(14-15-31-26(23)33)30-38-20(2)29(6,7)39-30/h10-15,17-18H,2,8-9,16H2,1,3-7H3 |
| InChIKey | RXOKAEWIOISZPF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|