C45H52N2O6 — CID 89221975
[4'-[(E)-3-(6-hexoxy-3-pyridinyl)prop-2-enyl]peroxy-3,3'-spirobi[1,2-dihydroindene]-4-yl] (E)-3-(6-hexoxy-3-pyridinyl)prop-2-enoate (PubChem CID 89221975) has the molecular formula C45H52N2O6 and a molecular weight of 716.92 g/mol. Its IUPAC name is [4'-[(E)-3-(6-hexoxy-3-pyridinyl)prop-2-enyl]peroxy-3,3'-spirobi[1,2-dihydroindene]-4-yl] (E)-3-(6-hexoxy-3-pyridinyl)prop-2-enoate.
| Compound Name | [4'-[(E)-3-(6-hexoxy-3-pyridinyl)prop-2-enyl]peroxy-3,3'-spirobi[1,2-dihydroindene]-4-yl] (E)-3-(6-hexoxy-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 89221975 |
| Molecular Formula | C45H52N2O6 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | [4'-[(E)-3-(6-hexoxy-3-pyridinyl)prop-2-enyl]peroxy-3,3'-spirobi[1,2-dihydroindene]-4-yl] (E)-3-(6-hexoxy-3-pyridinyl)prop-2-enoate |
| SMILES | CCCCCCOc1ccc(/C=C/COOc2cccc3c2C2(CC3)CCc3cccc(OC(=O)/C=C/c4ccc(OCCCCCC)nc4)c32)cn1 |
| InChI | InChI=1S/C45H52N2O6/c1-3-5-7-9-29-49-40-22-19-34(32-46-40)14-13-31-51-53-39-18-12-16-37-26-28-45(44(37)39)27-25-36-15-11-17-38(43(36)45)52-42(48)24-21-35-20-23-41(47-33-35)50-30-10-8-6-4-2/h11-24,32-33H,3-10,25-31H2,1-2H3/b14-13+,24-21+ |
| InChIKey | YBKXHMQZRMSAPU-ZFZDTVMUSA-N |
| XLogP | 10.22 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|