C16H28N2O3 — CID 89222192
N-[3-methyl-3-[3-methyl-3-(prop-2-enoylamino)butoxy]butyl]prop-2-enamide (PubChem CID 89222192) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[3-methyl-3-[3-methyl-3-(prop-2-enoylamino)butoxy]butyl]prop-2-enamide.
| Compound Name | N-[3-methyl-3-[3-methyl-3-(prop-2-enoylamino)butoxy]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 89222192 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[3-methyl-3-[3-methyl-3-(prop-2-enoylamino)butoxy]butyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(C)(C)OCCC(C)(C)NC(=O)C=C |
| InChI | InChI=1S/C16H28N2O3/c1-7-13(19)17-11-9-16(5,6)21-12-10-15(3,4)18-14(20)8-2/h7-8H,1-2,9-12H2,3-6H3,(H,17,19)(H,18,20) |
| InChIKey | VLBMVPUMXKOTJC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|