C13H12Cl2F3N3O2S — CID 89228882
1-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[hydroxy(sulfanyl)methyl]pyrazol-3-yl]ethanol (PubChem CID 89228882) has the molecular formula C13H12Cl2F3N3O2S and a molecular weight of 402.23 g/mol. Its IUPAC name is 1-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[hydroxy(sulfanyl)methyl]pyrazol-3-yl]ethanol.
| Compound Name | 1-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[hydroxy(sulfanyl)methyl]pyrazol-3-yl]ethanol |
|---|---|
| PubChem CID | 89228882 |
| Molecular Formula | C13H12Cl2F3N3O2S |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 1-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[hydroxy(sulfanyl)methyl]pyrazol-3-yl]ethanol |
| SMILES | CC(O)c1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1C(O)S |
| InChI | InChI=1S/C13H12Cl2F3N3O2S/c1-4(22)9-8(12(23)24)11(19)21(20-9)10-6(14)2-5(3-7(10)15)13(16,17)18/h2-4,12,22-24H,19H2,1H3 |
| InChIKey | FWHLEZDMRYIUKQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|