C12H14Cl3N3O2 — CID 89230130
3-methyl-2-oxo-N-[(2,4,6-trichlorocyclohexa-1,5-dien-1-yl)methyl]imidazolidine-4-carboxamide (PubChem CID 89230130) has the molecular formula C12H14Cl3N3O2 and a molecular weight of 338.62 g/mol. Its IUPAC name is 3-methyl-2-oxo-N-[(2,4,6-trichlorocyclohexa-1,5-dien-1-yl)methyl]imidazolidine-4-carboxamide.
| Compound Name | 3-methyl-2-oxo-N-[(2,4,6-trichlorocyclohexa-1,5-dien-1-yl)methyl]imidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 89230130 |
| Molecular Formula | C12H14Cl3N3O2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-methyl-2-oxo-N-[(2,4,6-trichlorocyclohexa-1,5-dien-1-yl)methyl]imidazolidine-4-carboxamide |
| SMILES | CN1C(=O)NCC1C(=O)NCC1=C(Cl)CC(Cl)C=C1Cl |
| InChI | InChI=1S/C12H14Cl3N3O2/c1-18-10(5-17-12(18)20)11(19)16-4-7-8(14)2-6(13)3-9(7)15/h2,6,10H,3-5H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | PWNDSJDTMMIEAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|