C12H15Cl2N3O2 — CID 89230145
N-[(2,3-dichlorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide (PubChem CID 89230145) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is N-[(2,3-dichlorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide.
| Compound Name | N-[(2,3-dichlorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 89230145 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-[(2,3-dichlorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
| SMILES | CN1C(=O)NCC1C(=O)NCC1=C(Cl)C(Cl)CC=C1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c1-17-9(6-16-12(17)19)11(18)15-5-7-3-2-4-8(13)10(7)14/h2-3,8-9H,4-6H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | UZXDPECHZKJACN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|