C21H15F2N3O5 — CID 89231663
ethyl 4-amino-5-(ethenylcarbamoyl)-10,11-difluoro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate (PubChem CID 89231663) has the molecular formula C21H15F2N3O5 and a molecular weight of 427.36 g/mol. Its IUPAC name is ethyl 4-amino-5-(ethenylcarbamoyl)-10,11-difluoro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate.
| Compound Name | ethyl 4-amino-5-(ethenylcarbamoyl)-10,11-difluoro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 89231663 |
| Molecular Formula | C21H15F2N3O5 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | ethyl 4-amino-5-(ethenylcarbamoyl)-10,11-difluoro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate |
| SMILES | C=CNC(=O)c1cc2c(cc1N)-n1cc(C(=O)OCC)c(=O)c3cc(F)c(F)c(c31)O2 |
| InChI | InChI=1S/C21H15F2N3O5/c1-3-25-20(28)9-6-15-14(7-13(9)24)26-8-11(21(29)30-4-2)18(27)10-5-12(22)16(23)19(31-15)17(10)26/h3,5-8H,1,4,24H2,2H3,(H,25,28) |
| InChIKey | JBVOQBRFYLEUDW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|