C24H23Cl3N2O2S — CID 89233156
1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-(1,5-dichloropentan-3-yloxy)benzimidazole (PubChem CID 89233156) has the molecular formula C24H23Cl3N2O2S and a molecular weight of 509.89 g/mol. Its IUPAC name is 1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-(1,5-dichloropentan-3-yloxy)benzimidazole.
| Compound Name | 1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-(1,5-dichloropentan-3-yloxy)benzimidazole |
|---|---|
| PubChem CID | 89233156 |
| Molecular Formula | C24H23Cl3N2O2S |
| Molecular Weight | 509.89 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-(1,5-dichloropentan-3-yloxy)benzimidazole |
| SMILES | C[C@@H](Oc1csc(-n2cnc3ccc(OC(CCCl)CCCl)cc32)c1)c1ccccc1Cl |
| InChI | InChI=1S/C24H23Cl3N2O2S/c1-16(20-4-2-3-5-21(20)27)30-19-13-24(32-14-19)29-15-28-22-7-6-18(12-23(22)29)31-17(8-10-25)9-11-26/h2-7,12-17H,8-11H2,1H3/t16-/m1/s1 |
| InChIKey | MIEWWLNLDCVDEO-MRXNPFEDSA-N |
| XLogP | 7.89 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.89 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|