C19H13Cl2FN2OS — CID 70911015
5-chloro-1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-fluorobenzimidazole (PubChem CID 70911015) has the molecular formula C19H13Cl2FN2OS and a molecular weight of 407.30 g/mol. Its IUPAC name is 5-chloro-1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-fluorobenzimidazole.
| Compound Name | 5-chloro-1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 70911015 |
| Molecular Formula | C19H13Cl2FN2OS |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 5-chloro-1-[4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]-6-fluorobenzimidazole |
| SMILES | C[C@@H](Oc1csc(-n2cnc3cc(Cl)c(F)cc32)c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H13Cl2FN2OS/c1-11(13-4-2-3-5-14(13)20)25-12-6-19(26-9-12)24-10-23-17-7-15(21)16(22)8-18(17)24/h2-11H,1H3/t11-/m1/s1 |
| InChIKey | UUXZSAZVQJAZOE-LLVKDONJSA-N |
| XLogP | 6.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |