C13H27NO2 — CID 89234417
2-tert-butyl-2-(hydroxymethyl)-4,4-dimethylhexanamide (PubChem CID 89234417) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-tert-butyl-2-(hydroxymethyl)-4,4-dimethylhexanamide.
| Compound Name | 2-tert-butyl-2-(hydroxymethyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 89234417 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-tert-butyl-2-(hydroxymethyl)-4,4-dimethylhexanamide |
| SMILES | CCC(C)(C)CC(CO)(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-7-12(5,6)8-13(9-15,10(14)16)11(2,3)4/h15H,7-9H2,1-6H3,(H2,14,16) |
| InChIKey | VARUGGPYEFRDKW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |