C10H15F3O6S2 — CID 89235765
2-prop-1-ynyl-6-(trifluoromethylsulfonyloxy)hexane-1-sulfonic acid (PubChem CID 89235765) has the molecular formula C10H15F3O6S2 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-prop-1-ynyl-6-(trifluoromethylsulfonyloxy)hexane-1-sulfonic acid.
| Compound Name | 2-prop-1-ynyl-6-(trifluoromethylsulfonyloxy)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 89235765 |
| Molecular Formula | C10H15F3O6S2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-prop-1-ynyl-6-(trifluoromethylsulfonyloxy)hexane-1-sulfonic acid |
| SMILES | CC#CC(CCCCOS(=O)(=O)C(F)(F)F)CS(=O)(=O)O |
| InChI | InChI=1S/C10H15F3O6S2/c1-2-5-9(8-20(14,15)16)6-3-4-7-19-21(17,18)10(11,12)13/h9H,3-4,6-8H2,1H3,(H,14,15,16) |
| InChIKey | QUUOWVPSBBCHIA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|