C21H28N4O3S — CID 89237255
N-[3,3,5,5-tetramethyl-1-(4-pyrazol-1-ylphenyl)sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89237255) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[3,3,5,5-tetramethyl-1-(4-pyrazol-1-ylphenyl)sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[3,3,5,5-tetramethyl-1-(4-pyrazol-1-ylphenyl)sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237255 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[3,3,5,5-tetramethyl-1-(4-pyrazol-1-ylphenyl)sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C(C)(C)CN(S(=O)(=O)c2ccc(-n3cccn3)cc2)CC1(C)C |
| InChI | InChI=1S/C21H28N4O3S/c1-6-18(26)23-19-20(2,3)14-24(15-21(19,4)5)29(27,28)17-10-8-16(9-11-17)25-13-7-12-22-25/h6-13,19H,1,14-15H2,2-5H3,(H,23,26) |
| InChIKey | RJKAXEUZRAHSAT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|