C27H35N3O4S — CID 89237192
N-benzyl-N-methyl-4-[3,3,5,5-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 89237192) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-[3,3,5,5-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-benzyl-N-methyl-4-[3,3,5,5-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89237192 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-benzyl-N-methyl-4-[3,3,5,5-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1C(C)(C)CN(S(=O)(=O)c2ccc(C(=O)N(C)Cc3ccccc3)cc2)CC1(C)C |
| InChI | InChI=1S/C27H35N3O4S/c1-7-23(31)28-25-26(2,3)18-30(19-27(25,4)5)35(33,34)22-15-13-21(14-16-22)24(32)29(6)17-20-11-9-8-10-12-20/h7-16,25H,1,17-19H2,2-6H3,(H,28,31) |
| InChIKey | MSSGKAXURFQEHF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|