C24H36N2O3S — CID 89237105
N-[1-(4-cyclohexylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide (PubChem CID 89237105) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is N-[1-(4-cyclohexylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-(4-cyclohexylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237105 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[1-(4-cyclohexylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C(C)(C)CN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC1(C)C |
| InChI | InChI=1S/C24H36N2O3S/c1-6-21(27)25-22-23(2,3)16-26(17-24(22,4)5)30(28,29)20-14-12-19(13-15-20)18-10-8-7-9-11-18/h6,12-15,18,22H,1,7-11,16-17H2,2-5H3,(H,25,27) |
| InChIKey | BXZDYXOKTBZFDA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|