C20H30N2O4S — CID 89239316
N-[1-(4-methoxy-3-methylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide (PubChem CID 89239316) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[1-(4-methoxy-3-methylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-(4-methoxy-3-methylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89239316 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[1-(4-methoxy-3-methylphenyl)sulfonyl-3,3,5,5-tetramethylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C(C)(C)CN(S(=O)(=O)c2ccc(OC)c(C)c2)CC1(C)C |
| InChI | InChI=1S/C20H30N2O4S/c1-8-17(23)21-18-19(3,4)12-22(13-20(18,5)6)27(24,25)15-9-10-16(26-7)14(2)11-15/h8-11,18H,1,12-13H2,2-7H3,(H,21,23) |
| InChIKey | HFBOIDJTNJIUIB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|