C20H19NO5S — CID 89239024
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)prop-2-en-1-one (PubChem CID 89239024) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 89239024 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(1-methylsulfonyl-2,3-dihydroindol-5-yl)prop-2-en-1-one |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)/C=C/c3ccc4c(c3)OCCO4)ccc21 |
| InChI | InChI=1S/C20H19NO5S/c1-27(23,24)21-9-8-15-13-16(4-5-17(15)21)18(22)6-2-14-3-7-19-20(12-14)26-11-10-25-19/h2-7,12-13H,8-11H2,1H3/b6-2+ |
| InChIKey | XSRVSOVSZYCUCV-QHHAFSJGSA-N |
| XLogP | 2.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|