C22H25NO3 — CID 89240007
ethyl 2-[6-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-2-methylpropanoate (PubChem CID 89240007) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl 2-[6-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[6-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 89240007 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl 2-[6-(4-aminophenyl)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1CCc2cc(-c3ccc(N)cc3)ccc2C1=O |
| InChI | InChI=1S/C22H25NO3/c1-4-26-21(25)22(2,3)19-12-8-16-13-15(7-11-18(16)20(19)24)14-5-9-17(23)10-6-14/h5-7,9-11,13,19H,4,8,12,23H2,1-3H3 |
| InChIKey | YQBZXCLPDHWJMB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|