C12H11N5O2S2 — CID 89241606
4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-methylsulfanyl-6-(sulfanylmethyl)pyrimidine-5-carbonitrile (PubChem CID 89241606) has the molecular formula C12H11N5O2S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-methylsulfanyl-6-(sulfanylmethyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-methylsulfanyl-6-(sulfanylmethyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 89241606 |
| Molecular Formula | C12H11N5O2S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-2-methylsulfanyl-6-(sulfanylmethyl)pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(CS)c(C#N)c(NN2C(=O)C=C(C)C2=O)n1 |
| InChI | InChI=1S/C12H11N5O2S2/c1-6-3-9(18)17(11(6)19)16-10-7(4-13)8(5-20)14-12(15-10)21-2/h3,20H,5H2,1-2H3,(H,14,15,16) |
| InChIKey | BCPLLTHVRRACDT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|