C21H15N5O2S — CID 25066085
4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-6-methylsulfanyl-2-naphthalen-1-ylpyrimidine-5-carbonitrile (PubChem CID 25066085) has the molecular formula C21H15N5O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-6-methylsulfanyl-2-naphthalen-1-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-6-methylsulfanyl-2-naphthalen-1-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 25066085 |
| Molecular Formula | C21H15N5O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-6-methylsulfanyl-2-naphthalen-1-ylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cccc3ccccc23)nc(NN2C(=O)C=C(C)C2=O)c1C#N |
| InChI | InChI=1S/C21H15N5O2S/c1-12-10-17(27)26(21(12)28)25-19-16(11-22)20(29-2)24-18(23-19)15-9-5-7-13-6-3-4-8-14(13)15/h3-10H,1-2H3,(H,23,24,25) |
| InChIKey | GXGHPLKLSXWHQO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|