C45H34N4O2 — CID 89244238
1-[4-[3-(4-acetylphenyl)-3-[2-amino-5-(2,3-diphenylquinoxalin-6-yl)phenyl]iminoprop-1-en-2-yl]phenyl]ethanone (PubChem CID 89244238) has the molecular formula C45H34N4O2 and a molecular weight of 662.79 g/mol. Its IUPAC name is 1-[4-[3-(4-acetylphenyl)-3-[2-amino-5-(2,3-diphenylquinoxalin-6-yl)phenyl]iminoprop-1-en-2-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-(4-acetylphenyl)-3-[2-amino-5-(2,3-diphenylquinoxalin-6-yl)phenyl]iminoprop-1-en-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 89244238 |
| Molecular Formula | C45H34N4O2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 1-[4-[3-(4-acetylphenyl)-3-[2-amino-5-(2,3-diphenylquinoxalin-6-yl)phenyl]iminoprop-1-en-2-yl]phenyl]ethanone |
| SMILES | C=C(/C(=N\c1cc(-c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)ccc1N)c1ccc(C(C)=O)cc1)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C45H34N4O2/c1-28(31-14-16-32(17-15-31)29(2)50)43(36-20-18-33(19-21-36)30(3)51)48-41-26-37(22-24-39(41)46)38-23-25-40-42(27-38)49-45(35-12-8-5-9-13-35)44(47-40)34-10-6-4-7-11-34/h4-27H,1,46H2,2-3H3/b48-43+ |
| InChIKey | FXPRMDNQEDJFKA-VIFQPKRCSA-N |
| XLogP | 10.45 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|