C15H12O3 — CID 89244516
9,10-dihydroxy-5,8-dihydroanthracene-2-carbaldehyde (PubChem CID 89244516) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 9,10-dihydroxy-5,8-dihydroanthracene-2-carbaldehyde.
| Compound Name | 9,10-dihydroxy-5,8-dihydroanthracene-2-carbaldehyde |
|---|---|
| PubChem CID | 89244516 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 9,10-dihydroxy-5,8-dihydroanthracene-2-carbaldehyde |
| SMILES | O=Cc1ccc2c(O)c3c(c(O)c2c1)CC=CC3 |
| InChI | InChI=1S/C15H12O3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-2,5-8,17-18H,3-4H2 |
| InChIKey | FIKUCYDSEPMOAG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|