C21H19N3O2 — CID 89248548
methyl 7-amino-1-(4-ethynylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 89248548) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 7-amino-1-(4-ethynylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 7-amino-1-(4-ethynylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 89248548 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 7-amino-1-(4-ethynylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | C#Cc1ccc(C2NC(C(=O)OC)Cc3c2[nH]c2cc(N)ccc32)cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-3-12-4-6-13(7-5-12)19-20-16(11-18(24-19)21(25)26-2)15-9-8-14(22)10-17(15)23-20/h1,4-10,18-19,23-24H,11,22H2,2H3 |
| InChIKey | RVSLSFHASKIXDL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|