C10H14N4O4 — CID 89250084
methyl 4-amino-5-carbamoyl-1-(4-oxobutyl)pyrazole-3-carboxylate (PubChem CID 89250084) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl 4-amino-5-carbamoyl-1-(4-oxobutyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-amino-5-carbamoyl-1-(4-oxobutyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 89250084 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl 4-amino-5-carbamoyl-1-(4-oxobutyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(CCCC=O)c(C(N)=O)c1N |
| InChI | InChI=1S/C10H14N4O4/c1-18-10(17)7-6(11)8(9(12)16)14(13-7)4-2-3-5-15/h5H,2-4,11H2,1H3,(H2,12,16) |
| InChIKey | VPMLJHFTGGDMSU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|