C23H21F2N7O2 — CID 89251955
4-[3-(6-amino-9-prop-2-ynylpurin-2-yl)prop-2-ynyl]-N-(3,4-difluorophenoxy)piperidine-1-carboxamide (PubChem CID 89251955) has the molecular formula C23H21F2N7O2 and a molecular weight of 465.46 g/mol. Its IUPAC name is 4-[3-(6-amino-9-prop-2-ynylpurin-2-yl)prop-2-ynyl]-N-(3,4-difluorophenoxy)piperidine-1-carboxamide.
| Compound Name | 4-[3-(6-amino-9-prop-2-ynylpurin-2-yl)prop-2-ynyl]-N-(3,4-difluorophenoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 89251955 |
| Molecular Formula | C23H21F2N7O2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-[3-(6-amino-9-prop-2-ynylpurin-2-yl)prop-2-ynyl]-N-(3,4-difluorophenoxy)piperidine-1-carboxamide |
| SMILES | C#CCn1cnc2c(N)nc(C#CCC3CCN(C(=O)NOc4ccc(F)c(F)c4)CC3)nc21 |
| InChI | InChI=1S/C23H21F2N7O2/c1-2-10-32-14-27-20-21(26)28-19(29-22(20)32)5-3-4-15-8-11-31(12-9-15)23(33)30-34-16-6-7-17(24)18(25)13-16/h1,6-7,13-15H,4,8-12H2,(H,30,33)(H2,26,28,29) |
| InChIKey | WAQMOPKQASENLL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|