C23H34N6O4 — CID 70993623
(2S)-2-[[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide (PubChem CID 70993623) has the molecular formula C23H34N6O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is (2S)-2-[[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide.
| Compound Name | (2S)-2-[[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 70993623 |
| Molecular Formula | C23H34N6O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (2S)-2-[[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide |
| SMILES | CCNC(=O)[C@@H](OCn1cnc2c(N)nc(C#CCC3CCC(CC)CC3)nc21)C(O)CO |
| InChI | InChI=1S/C23H34N6O4/c1-3-15-8-10-16(11-9-15)6-5-7-18-27-21(24)19-22(28-18)29(13-26-19)14-33-20(17(31)12-30)23(32)25-4-2/h13,15-17,20,30-31H,3-4,6,8-12,14H2,1-2H3,(H,25,32)(H2,24,27,28)/t15?,16?,17?,20-/m0/s1 |
| InChIKey | YXJCTYVPDRGNAI-ZHHSLPHTSA-N |
| XLogP | 1.20 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|